* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HANSA UC440 |
| English Synonyms: | HANSA UC440 |
| MDL Number.: | MFCD16618088 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | COc1cccc(c1)C(C(C(F)(F)F)(F)F)O |
| InChi: | InChI=1S/C10H9F5O2/c1-17-7-4-2-3-6(5-7)8(16)9(11,12)10(13,14)15/h2-5,8,16H,1H3 |
| InChiKey: | InChIKey=BFYZGXYJSIXBQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.