* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,14-DIHYDRO-14-METHYL-11-(TRIFLUOROMETHYL)-INDOLO[2',3':3,4]PYRIDO[2,1-B]QUINAZOLIN-5(7H)-ONE |
| CAS: | 747-91-1 |
| English Synonyms: | 8,14-DIHYDRO-14-METHYL-11-(TRIFLUOROMETHYL)-INDOLO[2',3':3,4]PYRIDO[2,1-B]QUINAZOLIN-5(7H)-ONE |
| MDL Number.: | MFCD16619129 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CN1c2ccccc2C(=O)N3C1=C4C(=c5ccc(cc5=N4)C(F)(F)F)CC3 |
| InChi: | InChI=1S/C20H14F3N3O/c1-25-16-5-3-2-4-14(16)19(27)26-9-8-13-12-7-6-11(20(21,22)23)10-15(12)24-17(13)18(25)26/h2-7,10H,8-9H2,1H3 |
| InChiKey: | InChIKey=TVPSQSGTBLYMFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.