* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-AMINO-1,5-DIHYDRO-4H-PYRAZOLO[3,4-D]PYRIMIDIN-4-ONE |
| CAS: | 81375-79-3 |
| English Synonyms: | 5-AMINO-1,5-DIHYDRO-4H-PYRAZOLO[3,4-D]PYRIMIDIN-4-ONE |
| MDL Number.: | MFCD16619842 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1c2c([nH]n1)ncn(c2=O)N |
| InChi: | InChI=1S/C5H5N5O/c6-10-2-7-4-3(5(10)11)1-8-9-4/h1-2H,6H2,(H,8,9) |
| InChiKey: | InChIKey=YSYKXLIFNZGVCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.