* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIMORPHECOLIC ACID |
| English Synonyms: | DIMORPHECOLIC ACID |
| MDL Number.: | MFCD16621254 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCC/C=C/C=C/[C@H](CCCCCCCC(=O)O)O |
| InChi: | InChI=1S/C18H32O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14,17,19H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6+,14-11+/t17-/m1/s1 |
| InChiKey: | InChIKey=NPDSHTNEKLQQIJ-RUDINFOGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.