* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KIC-ARGININE |
| CAS: | 72087-40-2 |
| English Synonyms: | KIC-ARGININE |
| MDL Number.: | MFCD16621289 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | CC(C)CC(=O)C(O)=O.N[C@@H](CCCNC(N)=N)C(O)=O |
| InChi: | InChI=1S/C6H14N4O2.C6H10O3/c7-4(5(11)12)2-1-3-10-6(8)9;1-4(2)3-5(7)6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);4H,3H2,1-2H3,(H,8,9)/t4-;/m0./s1 |
| InChiKey: | InChIKey=MOZIGXHKOXEDLJ-WCCKRBBISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.