* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRAZOLO[1,5-A:3,4-C']DIPYRIDINE |
CAS: | 1029940-70-2 |
English Synonyms: | PYRAZOLO[1,5-A:3,4-C']DIPYRIDINE |
MDL Number.: | MFCD16621367 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccn2c(c1)c3ccncc3n2 |
InChi: | InChI=1S/C10H7N3/c1-2-6-13-10(3-1)8-4-5-11-7-9(8)12-13/h1-7H |
InChiKey: | InChIKey=MVHFWCULBHVJGP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.