* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHOSPHOCITRATE |
CAS: | 2565-87-9 |
English Synonyms: | PHOSPHOCITRATE |
MDL Number.: | MFCD16621771 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CC(=O)CC(CC(=O)O)(C(=O)O)OP(=O)(O)O |
InChi: | InChI=1S/C7H11O9P/c1-4(8)2-7(6(11)12,3-5(9)10)16-17(13,14)15/h2-3H2,1H3,(H,9,10)(H,11,12)(H2,13,14,15) |
InChiKey: | InChIKey=BTGISVGMCFMFAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.