* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINOLINE-6,8-DIAMINE |
English Synonyms: | QUINOLINE-6,8-DIAMINE ; ZERENEX E/1081557 |
MDL Number.: | MFCD16631214 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc2cc(cc(c2nc1)N)N |
InChi: | InChI=1S/C9H9N3/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h1-5H,10-11H2 |
InChiKey: | InChIKey=OQTZPUWGBDDBEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.