* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOPENTASILANE |
| CAS: | 289-22-5 |
| English Synonyms: | CYCLOPENTASILANE |
| MDL Number.: | MFCD16657026 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | [SiH2]1[SiH2][SiH2][SiH2][SiH2]1 |
| InChi: | InChI=1S/H10Si5/c1-2-4-5-3-1/h1-5H2 |
| InChiKey: | InChIKey=CVLHDNLPWKYNNR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.