* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-PHENYLFURO[3,4-D]PYRIMIDINE-5,7-DIONE |
| CAS: | 64074-27-7 |
| English Synonyms: | 2-PHENYLFURO[3,4-D]PYRIMIDINE-5,7-DIONE |
| MDL Number.: | MFCD16657339 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2ncc3c(n2)C(=O)OC3=O |
| InChi: | InChI=1S/C12H6N2O3/c15-11-8-6-13-10(7-4-2-1-3-5-7)14-9(8)12(16)17-11/h1-6H |
| InChiKey: | InChIKey=NZVZCBXFSLAMNH-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.