* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-2'-METHOXY-1,1'-BIPHENYL |
CAS: | 20837-12-1 |
English Synonyms: | 2-BROMO-2'-METHOXY-1,1'-BIPHENYL |
MDL Number.: | MFCD16659071 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | COc1ccccc1c2ccccc2Br |
InChi: | InChI=1S/C13H11BrO/c1-15-13-9-5-3-7-11(13)10-6-2-4-8-12(10)14/h2-9H,1H3 |
InChiKey: | InChIKey=ZAQLWMUDNQIIJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.