* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-4,4'-DIMETHOXY-7,7'-DIHYDROXY-1,1'-SPIROBIINDANE |
CAS: | 636601-30-4 |
English Synonyms: | (S)-4,4'-DIMETHOXY-7,7'-DIHYDROXY-1,1'-SPIROBIINDANE |
MDL Number.: | MFCD16660946 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COc1ccc(c2c1CCC23CCc4c3c(ccc4OC)O)O |
InChi: | InChI=1S/C19H20O4/c1-22-15-5-3-13(20)17-11(15)7-9-19(17)10-8-12-16(23-2)6-4-14(21)18(12)19/h3-6,20-21H,7-10H2,1-2H3 |
InChiKey: | InChIKey=ZNAUCOHQLKNXSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.