* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33875219 |
English Synonyms: | UKRORGSYN-BB BBV-33875219 |
MDL Number.: | MFCD16664859 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C[C@@H](C(=O)OC)NCc1cccn1C |
InChi: | InChI=1S/C10H16N2O2/c1-8(10(13)14-3)11-7-9-5-4-6-12(9)2/h4-6,8,11H,7H2,1-3H3/t8-/m0/s1 |
InChiKey: | InChIKey=BEUZOXXLKKDSQJ-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.