* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33206780 |
English Synonyms: | UKRORGSYN-BB BBV-33206780 |
MDL Number.: | MFCD16666062 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@H](C(=O)O)NC(=O)CC1CC1 |
InChi: | InChI=1S/C8H13NO3/c1-5(8(11)12)9-7(10)4-6-2-3-6/h5-6H,2-4H2,1H3,(H,9,10)(H,11,12)/t5-/m1/s1 |
InChiKey: | InChIKey=ZNQYAPRHFLLAPG-RXMQYKEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.