* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33249205 |
English Synonyms: | UKRORGSYN-BB BBV-33249205 |
MDL Number.: | MFCD16666077 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1ccsc1C(=O)CC2CC2 |
InChi: | InChI=1S/C10H12OS/c1-7-4-5-12-10(7)9(11)6-8-2-3-8/h4-5,8H,2-3,6H2,1H3 |
InChiKey: | InChIKey=ZYWFWGBZMFMTSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.