* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33485026 |
English Synonyms: | UKRORGSYN-BB BBV-33485026 |
MDL Number.: | MFCD16666121 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C1CC2CCC1C2)NC3CCC3 |
InChi: | InChI=1S/C13H23N/c1-9(14-12-3-2-4-12)13-8-10-5-6-11(13)7-10/h9-14H,2-8H2,1H3 |
InChiKey: | InChIKey=XGDYMWNQPQKOQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.