* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33810962 |
English Synonyms: | UKRORGSYN-BB BBV-33810962 |
MDL Number.: | MFCD16666760 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | NCC1=CN(CC2CCCCC2)N=N1 |
InChi: | InChI=1S/C10H18N4/c11-6-10-8-14(13-12-10)7-9-4-2-1-3-5-9/h8-9H,1-7,11H2 |
InChiKey: | InChIKey=BKMGELPPCPUMLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.