* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811509 |
English Synonyms: | UKRORGSYN-BB BBV-33811509 |
MDL Number.: | MFCD16667238 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | NC1CCN(C1)S(=O)(=O)C1=CC=C(Cl)S1 |
InChi: | InChI=1S/C8H11ClN2O2S2/c9-7-1-2-8(14-7)15(12,13)11-4-3-6(10)5-11/h1-2,6H,3-5,10H2 |
InChiKey: | InChIKey=CNWOZXFDCRMNDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.