* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811577 |
English Synonyms: | UKRORGSYN-BB BBV-33811577 |
MDL Number.: | MFCD16667290 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CN1C=CC=C1C(=O)CN1CCC(N)C1 |
InChi: | InChI=1S/C11H17N3O/c1-13-5-2-3-10(13)11(15)8-14-6-4-9(12)7-14/h2-3,5,9H,4,6-8,12H2,1H3 |
InChiKey: | InChIKey=UUQGJVCZMIBXDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.