* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811587 |
English Synonyms: | UKRORGSYN-BB BBV-33811587 |
MDL Number.: | MFCD16667299 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC1CCN(C1)C(=O)\C=C\C(O)=O |
InChi: | InChI=1S/C8H12N2O3/c9-6-3-4-10(5-6)7(11)1-2-8(12)13/h1-2,6H,3-5,9H2,(H,12,13)/b2-1+ |
InChiKey: | InChIKey=XLQSDIJRHZDAIB-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.