* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811664 |
English Synonyms: | UKRORGSYN-BB BBV-33811664 |
MDL Number.: | MFCD16667367 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCN1N=NN=C1CN1CCC(N)C1 |
InChi: | InChI=1S/C9H18N6/c1-2-4-15-9(11-12-13-15)7-14-5-3-8(10)6-14/h8H,2-7,10H2,1H3 |
InChiKey: | InChIKey=XSFSAXLVGOMBPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.