* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812273 |
English Synonyms: | UKRORGSYN-BB BBV-33812273 |
MDL Number.: | MFCD16667902 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C#N)NS(=O)(=O)c1cnn(c1)C |
InChi: | InChI=1S/C7H10N4O2S/c1-6(3-8)10-14(12,13)7-4-9-11(2)5-7/h4-6,10H,1-2H3 |
InChiKey: | InChIKey=LSVOZHSAXDKCDU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.