* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812279 |
English Synonyms: | UKRORGSYN-BB BBV-33812279 |
MDL Number.: | MFCD16667908 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cn1cc(cn1)S(=O)(=O)NCC(=S)N |
InChi: | InChI=1S/C6H10N4O2S2/c1-10-4-5(2-8-10)14(11,12)9-3-6(7)13/h2,4,9H,3H2,1H3,(H2,7,13) |
InChiKey: | InChIKey=IUMPLPLHDQTAJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.