* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41219506 |
English Synonyms: | UKRORGSYN-BB BBV-41219506 |
MDL Number.: | MFCD16667925 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1nc(cn1C)S(=O)(=O)NC(C)CO |
InChi: | InChI=1S/C8H15N3O3S/c1-6(5-12)10-15(13,14)8-4-11(3)7(2)9-8/h4,6,10,12H,5H2,1-3H3 |
InChiKey: | InChIKey=OGMBFMIBTZSZIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.