* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812302 |
English Synonyms: | UKRORGSYN-BB BBV-33812302 |
MDL Number.: | MFCD16667929 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | Cn1cc(cn1)S(=O)(=O)NC/C(=N/O)/N |
InChi: | InChI=1S/C6H11N5O3S/c1-11-4-5(2-8-11)15(13,14)9-3-6(7)10-12/h2,4,9,12H,3H2,1H3,(H2,7,10) |
InChiKey: | InChIKey=LHUIRIXBJCYJKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.