* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIPROPYL-1,3-THIAZOL-5-AMINE |
| English Synonyms: | DIPROPYL-1,3-THIAZOL-5-AMINE |
| MDL Number.: | MFCD16669991 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCc1c(sc(n1)CCC)N |
| InChi: | InChI=1S/C9H16N2S/c1-3-5-7-9(10)12-8(11-7)6-4-2/h3-6,10H2,1-2H3 |
| InChiKey: | InChIKey=YFQCHQSTXMDUJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.