* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(4-BROMOPHENOXY)PENTAN-1-OL |
CAS: | 60222-73-3 |
English Synonyms: | 5-(4-BROMOPHENOXY)PENTAN-1-OL |
MDL Number.: | MFCD16696907 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1OCCCCCO)Br |
InChi: | InChI=1S/C11H15BrO2/c12-10-4-6-11(7-5-10)14-9-3-1-2-8-13/h4-7,13H,1-3,8-9H2 |
InChiKey: | InChIKey=ZDSHTXPXOFPDNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.