* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PENT-4-YN-2-ONE |
English Synonyms: | PENT-4-YN-2-ONE |
MDL Number.: | MFCD16698235 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)CC#C |
InChi: | InChI=1S/C5H6O/c1-3-4-5(2)6/h1H,4H2,2H3 |
InChiKey: | InChIKey=ASVQKRFMRKDHTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.