* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-PROPYL-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
| English Synonyms: | 9-PROPYL-1,4-DIAZASPIRO[5.5]UNDECAN-5-ONE |
| MDL Number.: | MFCD16715595 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCC1CCC2(CC1)C(=O)NCCN2 |
| InChi: | InChI=1S/C12H22N2O/c1-2-3-10-4-6-12(7-5-10)11(15)13-8-9-14-12/h10,14H,2-9H2,1H3,(H,13,15) |
| InChiKey: | InChIKey=BZNSWYRBTPMTNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.