* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL(([5-(PYRIDIN-2-YL)-1,3,4-OXADIAZOL-2-YL]METHYL))AMINE |
English Synonyms: | PROPYL(([5-(PYRIDIN-2-YL)-1,3,4-OXADIAZOL-2-YL]METHYL))AMINE |
MDL Number.: | MFCD16718764 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCNCc1nnc(o1)c2ccccn2 |
InChi: | InChI=1S/C11H14N4O/c1-2-6-12-8-10-14-15-11(16-10)9-5-3-4-7-13-9/h3-5,7,12H,2,6,8H2,1H3 |
InChiKey: | InChIKey=WHZXAMZVEXKKCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.