* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-(2-METHYLCYCLOPROPYL)-[1,2,3,4]TETRAZOLO[1,5-A]PYRAZIN-5-AMINE |
| English Synonyms: | N-(2-METHYLCYCLOPROPYL)-[1,2,3,4]TETRAZOLO[1,5-A]PYRAZIN-5-AMINE |
| MDL Number.: | MFCD16750651 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC1CC1Nc2cncc3n2nnn3 |
| InChi: | InChI=1S/C8H10N6/c1-5-2-6(5)10-7-3-9-4-8-11-12-13-14(7)8/h3-6,10H,2H2,1H3 |
| InChiKey: | InChIKey=CJHUXNVHVHUKQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.