* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225748 |
English Synonyms: | UKRORGSYN-BB BBV-34225748 |
MDL Number.: | MFCD16751185 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COCc1cc(n(n1)C2CCCC2)S |
InChi: | InChI=1S/C10H16N2OS/c1-13-7-8-6-10(14)12(11-8)9-4-2-3-5-9/h6,9,14H,2-5,7H2,1H3 |
InChiKey: | InChIKey=YHQKIIBZUHAOQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.