* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225770 |
English Synonyms: | UKRORGSYN-BB BBV-34225770 |
MDL Number.: | MFCD16751207 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C)n1c(cc(n1)COC)S |
InChi: | InChI=1S/C8H14N2OS/c1-6(2)10-8(12)4-7(9-10)5-11-3/h4,6,12H,5H2,1-3H3 |
InChiKey: | InChIKey=PKLKEAKFPIMMPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.