* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225772 |
English Synonyms: | UKRORGSYN-BB BBV-34225772 |
MDL Number.: | MFCD16751209 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(C1CC1)n2c(cc(n2)C(F)(F)F)S |
InChi: | InChI=1S/C9H11F3N2S/c1-5(6-2-3-6)14-8(15)4-7(13-14)9(10,11)12/h4-6,15H,2-3H2,1H3 |
InChiKey: | InChIKey=RQOAROPVLDMWCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.