* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(HEXAN-2-YL)-3,6-DIMETHYL-1,5-DIAZOCANE |
English Synonyms: | 1-(HEXAN-2-YL)-3,6-DIMETHYL-1,5-DIAZOCANE |
MDL Number.: | MFCD16751847 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCC(C)N1CCC(NCC(C1)C)C |
InChi: | InChI=1S/C14H30N2/c1-5-6-7-14(4)16-9-8-13(3)15-10-12(2)11-16/h12-15H,5-11H2,1-4H3 |
InChiKey: | InChIKey=OWIMPPUINRCIMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.