* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[(4-PHENYLPHENYL)AMINO]ETHAN-1-OL |
English Synonyms: | 2-[(4-PHENYLPHENYL)AMINO]ETHAN-1-OL |
MDL Number.: | MFCD16751871 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2ccc(cc2)NCCO |
InChi: | InChI=1S/C14H15NO/c16-11-10-15-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-16H,10-11H2 |
InChiKey: | InChIKey=VRTIWORNMJICJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.