* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-ETHYL-6-PROPANOYL-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| English Synonyms: | 3-ETHYL-6-PROPANOYL-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
| MDL Number.: | MFCD16751906 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC(=O)c1ccc2c(c1)oc(=O)n2CC |
| InChi: | InChI=1S/C12H13NO3/c1-3-10(14)8-5-6-9-11(7-8)16-12(15)13(9)4-2/h5-7H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=MDSZSWDVUYEMNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.