* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(4-BUTYLPHENYL)-1-ETHYLGUANIDINE |
| English Synonyms: | 3-(4-BUTYLPHENYL)-1-ETHYLGUANIDINE |
| MDL Number.: | MFCD16753719 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | CCCCc1ccc(cc1)NC(=N)NCC |
| InChi: | InChI=1S/C13H21N3/c1-3-5-6-11-7-9-12(10-8-11)16-13(14)15-4-2/h7-10H,3-6H2,1-2H3,(H3,14,15,16) |
| InChiKey: | InChIKey=CZTKWYJUHUILEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.