* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2,3-DIHYDRO-1H-INDEN-1-YL)-1-PROPYLGUANIDINE |
| English Synonyms: | 3-(2,3-DIHYDRO-1H-INDEN-1-YL)-1-PROPYLGUANIDINE |
| MDL Number.: | MFCD16753736 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | CCCNC(=N)NC1CCc2c1cccc2 |
| InChi: | InChI=1S/C13H19N3/c1-2-9-15-13(14)16-12-8-7-10-5-3-4-6-11(10)12/h3-6,12H,2,7-9H2,1H3,(H3,14,15,16) |
| InChiKey: | InChIKey=GSNHNACJPXCKEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.