* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2,3-DIHYDRO-1H-INDEN-1-YL)-1-(PROPAN-2-YL)GUANIDINE |
English Synonyms: | 3-(2,3-DIHYDRO-1H-INDEN-1-YL)-1-(PROPAN-2-YL)GUANIDINE |
MDL Number.: | MFCD16753737 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | CC(C)NC(=N)NC1CCc2c1cccc2 |
InChi: | InChI=1S/C13H19N3/c1-9(2)15-13(14)16-12-8-7-10-5-3-4-6-11(10)12/h3-6,9,12H,7-8H2,1-2H3,(H3,14,15,16) |
InChiKey: | InChIKey=KTSMSOMVWBMDAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.