* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FLUORO-1-(3-METHYLBUTYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| English Synonyms: | 6-FLUORO-1-(3-METHYLBUTYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| MDL Number.: | MFCD16754313 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)CCn1c2cc(ccc2nc1S)F |
| InChi: | InChI=1S/C12H15FN2S/c1-8(2)5-6-15-11-7-9(13)3-4-10(11)14-12(15)16/h3-4,7-8H,5-6H2,1-2H3,(H,14,16) |
| InChiKey: | InChIKey=HQZICECSPZMTRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.