* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FLUORO-1-PENTYL-1H-1,3-BENZODIAZOLE-2-THIOL |
| English Synonyms: | 6-FLUORO-1-PENTYL-1H-1,3-BENZODIAZOLE-2-THIOL |
| MDL Number.: | MFCD16754317 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCCn1c2cc(ccc2nc1S)F |
| InChi: | InChI=1S/C12H15FN2S/c1-2-3-4-7-15-11-8-9(13)5-6-10(11)14-12(15)16/h5-6,8H,2-4,7H2,1H3,(H,14,16) |
| InChiKey: | InChIKey=LFEVZPNGEBVWPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.