* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FLUORO-1-(2,2,2-TRIFLUOROETHYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| English Synonyms: | 6-FLUORO-1-(2,2,2-TRIFLUOROETHYL)-1H-1,3-BENZODIAZOLE-2-THIOL |
| MDL Number.: | MFCD16754323 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1F)n(c(n2)S)CC(F)(F)F |
| InChi: | InChI=1S/C9H6F4N2S/c10-5-1-2-6-7(3-5)15(8(16)14-6)4-9(11,12)13/h1-3H,4H2,(H,14,16) |
| InChiKey: | InChIKey=PZWLTCTZPCRQLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.