* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-FLUORO-1-PENTYL-1H-1,3-BENZODIAZOL-2-AMINE |
English Synonyms: | 6-FLUORO-1-PENTYL-1H-1,3-BENZODIAZOL-2-AMINE |
MDL Number.: | MFCD16754347 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCCn1c2cc(ccc2nc1N)F |
InChi: | InChI=1S/C12H16FN3/c1-2-3-4-7-16-11-8-9(13)5-6-10(11)15-12(16)14/h5-6,8H,2-4,7H2,1H3,(H2,14,15) |
InChiKey: | InChIKey=BCZYOOKLTLUPBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.