* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-FLUORO-1-(PENTAN-2-YL)-1H-1,3-BENZODIAZOL-2-AMINE |
English Synonyms: | 6-FLUORO-1-(PENTAN-2-YL)-1H-1,3-BENZODIAZOL-2-AMINE |
MDL Number.: | MFCD16754349 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCC(C)n1c2cc(ccc2nc1N)F |
InChi: | InChI=1S/C12H16FN3/c1-3-4-8(2)16-11-7-9(13)5-6-10(11)15-12(16)14/h5-8H,3-4H2,1-2H3,(H2,14,15) |
InChiKey: | InChIKey=DCKVOODQJXJNOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.