* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FLUORO-1-(2,2,2-TRIFLUOROETHYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| English Synonyms: | 6-FLUORO-1-(2,2,2-TRIFLUOROETHYL)-1H-1,3-BENZODIAZOL-2-AMINE |
| MDL Number.: | MFCD16754350 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1F)n(c(n2)N)CC(F)(F)F |
| InChi: | InChI=1S/C9H7F4N3/c10-5-1-2-6-7(3-5)16(8(14)15-6)4-9(11,12)13/h1-3H,4H2,(H2,14,15) |
| InChiKey: | InChIKey=HGAFQXWYTALPSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.