* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2-ETHYLPHENYL)-2-[(PROP-2-EN-1-YL)AMINO]ACETIC ACID |
English Synonyms: | 2-(2-ETHYLPHENYL)-2-[(PROP-2-EN-1-YL)AMINO]ACETIC ACID |
MDL Number.: | MFCD16755561 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCc1ccccc1C(C(=O)O)NCC=C |
InChi: | InChI=1S/C13H17NO2/c1-3-9-14-12(13(15)16)11-8-6-5-7-10(11)4-2/h3,5-8,12,14H,1,4,9H2,2H3,(H,15,16) |
InChiKey: | InChIKey=YZKIUCOJDDZDGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.