* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1-[(DIMETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-OL |
English Synonyms: | 2-(1-[(DIMETHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]-1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-OL |
MDL Number.: | MFCD16756214 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1nnc(n1C)Cn2cc(nn2)CCO |
InChi: | InChI=1S/C9H14N6O/c1-7-10-12-9(14(7)2)6-15-5-8(3-4-16)11-13-15/h5,16H,3-4,6H2,1-2H3 |
InChiKey: | InChIKey=FLJJAGQVMFIQMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.