* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | METHYL[3-(1,4-THIAZEPAN-4-YL)BUTYL]AMINE |
English Synonyms: | METHYL[3-(1,4-THIAZEPAN-4-YL)BUTYL]AMINE |
MDL Number.: | MFCD16758578 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(CCNC)N1CCCSCC1 |
InChi: | InChI=1S/C10H22N2S/c1-10(4-5-11-2)12-6-3-8-13-9-7-12/h10-11H,3-9H2,1-2H3 |
InChiKey: | InChIKey=KUYZSONRUFZQGB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.