* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1,4-THIAZEPAN-4-YL)PENTAN-1-AMINE |
| English Synonyms: | 4-(1,4-THIAZEPAN-4-YL)PENTAN-1-AMINE |
| MDL Number.: | MFCD16758585 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(CCCN)N1CCCSCC1 |
| InChi: | InChI=1S/C10H22N2S/c1-10(4-2-5-11)12-6-3-8-13-9-7-12/h10H,2-9,11H2,1H3 |
| InChiKey: | InChIKey=XKZQFLQCLZGSKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.